C14H22N4O3 — CID 102953442
[2,6-dioxaspiro[4.5]decan-9-yl-(6-methoxypyrimidin-4-yl)methyl]hydrazine (PubChem CID 102953442) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is [2,6-dioxaspiro[4.5]decan-9-yl-(6-methoxypyrimidin-4-yl)methyl]hydrazine.
| Compound Name | [2,6-dioxaspiro[4.5]decan-9-yl-(6-methoxypyrimidin-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 102953442 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | [2,6-dioxaspiro[4.5]decan-9-yl-(6-methoxypyrimidin-4-yl)methyl]hydrazine |
| SMILES | COc1cc(C(NN)C2CCOC3(CCOC3)C2)ncn1 |
| InChI | InChI=1S/C14H22N4O3/c1-19-12-6-11(16-9-17-12)13(18-15)10-2-4-21-14(7-10)3-5-20-8-14/h6,9-10,13,18H,2-5,7-8,15H2,1H3 |
| InChIKey | GOHQTVJBSAEJBF-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|