C16H28O4 — CID 116753294
2,6-dioxaspiro[4.5]decan-9-yl-(1-methoxycyclohexyl)methanol (PubChem CID 116753294) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2,6-dioxaspiro[4.5]decan-9-yl-(1-methoxycyclohexyl)methanol.
| Compound Name | 2,6-dioxaspiro[4.5]decan-9-yl-(1-methoxycyclohexyl)methanol |
|---|---|
| PubChem CID | 116753294 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2,6-dioxaspiro[4.5]decan-9-yl-(1-methoxycyclohexyl)methanol |
| SMILES | COC1(C(O)C2CCOC3(CCOC3)C2)CCCCC1 |
| InChI | InChI=1S/C16H28O4/c1-18-16(6-3-2-4-7-16)14(17)13-5-9-20-15(11-13)8-10-19-12-15/h13-14,17H,2-12H2,1H3 |
| InChIKey | UCEIJIWYBIKPPY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |