C16H28O3 — CID 79913506
2,6-dioxaspiro[4.5]decan-9-yl-(3-methylcyclohexyl)methanol (PubChem CID 79913506) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2,6-dioxaspiro[4.5]decan-9-yl-(3-methylcyclohexyl)methanol.
| Compound Name | 2,6-dioxaspiro[4.5]decan-9-yl-(3-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 79913506 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 2,6-dioxaspiro[4.5]decan-9-yl-(3-methylcyclohexyl)methanol |
| SMILES | CC1CCCC(C(O)C2CCOC3(CCOC3)C2)C1 |
| InChI | InChI=1S/C16H28O3/c1-12-3-2-4-13(9-12)15(17)14-5-7-19-16(10-14)6-8-18-11-16/h12-15,17H,2-11H2,1H3 |
| InChIKey | VDXVQZWJAILONT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |