C15H26O3 — CID 79913146
cyclopentyl(1,9-dioxaspiro[5.5]undecan-4-yl)methanol (PubChem CID 79913146) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is cyclopentyl(1,9-dioxaspiro[5.5]undecan-4-yl)methanol.
| Compound Name | cyclopentyl(1,9-dioxaspiro[5.5]undecan-4-yl)methanol |
|---|---|
| PubChem CID | 79913146 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | cyclopentyl(1,9-dioxaspiro[5.5]undecan-4-yl)methanol |
| SMILES | OC(C1CCCC1)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C15H26O3/c16-14(12-3-1-2-4-12)13-5-8-18-15(11-13)6-9-17-10-7-15/h12-14,16H,1-11H2 |
| InChIKey | FBXNXNPTNJDHHU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |