C15H26O4 — CID 115820899
1,9-dioxaspiro[5.5]undecan-4-yl(oxan-2-yl)methanol (PubChem CID 115820899) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1,9-dioxaspiro[5.5]undecan-4-yl(oxan-2-yl)methanol.
| Compound Name | 1,9-dioxaspiro[5.5]undecan-4-yl(oxan-2-yl)methanol |
|---|---|
| PubChem CID | 115820899 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 1,9-dioxaspiro[5.5]undecan-4-yl(oxan-2-yl)methanol |
| SMILES | OC(C1CCOC2(CCOCC2)C1)C1CCCCO1 |
| InChI | InChI=1S/C15H26O4/c16-14(13-3-1-2-7-18-13)12-4-8-19-15(11-12)5-9-17-10-6-15/h12-14,16H,1-11H2 |
| InChIKey | KHQPGCHPVAALBQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |