C14H24O4S — CID 79963284
1,9-dioxaspiro[5.5]undecan-4-yl(1,4-oxathian-2-yl)methanol (PubChem CID 79963284) has the molecular formula C14H24O4S and a molecular weight of 288.41 g/mol. Its IUPAC name is 1,9-dioxaspiro[5.5]undecan-4-yl(1,4-oxathian-2-yl)methanol.
| Compound Name | 1,9-dioxaspiro[5.5]undecan-4-yl(1,4-oxathian-2-yl)methanol |
|---|---|
| PubChem CID | 79963284 |
| Molecular Formula | C14H24O4S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1,9-dioxaspiro[5.5]undecan-4-yl(1,4-oxathian-2-yl)methanol |
| SMILES | OC(C1CCOC2(CCOCC2)C1)C1CSCCO1 |
| InChI | InChI=1S/C14H24O4S/c15-13(12-10-19-8-7-17-12)11-1-4-18-14(9-11)2-5-16-6-3-14/h11-13,15H,1-10H2 |
| InChIKey | WREXINAFHZMGJT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |