C13H22O3S2 — CID 79962909
1,4-oxathian-2-yl(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanol (PubChem CID 79962909) has the molecular formula C13H22O3S2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 1,4-oxathian-2-yl(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanol.
| Compound Name | 1,4-oxathian-2-yl(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanol |
|---|---|
| PubChem CID | 79962909 |
| Molecular Formula | C13H22O3S2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1,4-oxathian-2-yl(6-oxa-2-thiaspiro[4.5]decan-9-yl)methanol |
| SMILES | OC(C1CCOC2(CCSC2)C1)C1CSCCO1 |
| InChI | InChI=1S/C13H22O3S2/c14-12(11-8-17-6-4-15-11)10-1-3-16-13(7-10)2-5-18-9-13/h10-12,14H,1-9H2 |
| InChIKey | ZEOWKTRWWGGZFS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |