2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid

C11H18O4 — CID 79899396

IUPAC2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid
SMILESO=C(O)CC1CCOC2(CCOCC2)C1
InChIInChI=1S/C11H18O4/c12-10(13)7-9-1-4-15-11(8-9)2-5-14-6-3-11/h9H,1-8H2,(H,12,13)
InChIKeyZUNUKUPQWRWDNJ-UHFFFAOYSA-N
MW214.26 g/mol
LogP1.44
Rot. Bonds2

About 2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid

2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid (PubChem CID 79899396) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid.

Molecular Properties

Compound Name2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid
PubChem CID79899396
Molecular FormulaC11H18O4
Molecular Weight214.26 g/mol
Exact Mass214.12
IUPAC Name2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid
SMILESO=C(O)CC1CCOC2(CCOCC2)C1
InChIInChI=1S/C11H18O4/c12-10(13)7-9-1-4-15-11(8-9)2-5-14-6-3-11/h9H,1-8H2,(H,12,13)
InChIKeyZUNUKUPQWRWDNJ-UHFFFAOYSA-N
XLogP1.44
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.26
LogP ≤ 51.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid?
The IUPAC name of 2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid (CID 79899396) is 2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid.
What is the SMILES notation for 2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid?
The canonical SMILES for 2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid is O=C(O)CC1CCOC2(CCOCC2)C1.
What is the InChIKey of 2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid?
The InChIKey is ZUNUKUPQWRWDNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c12-10(13)7-9-1-4-15-11(8-9)2-5-14-6-3-11/h9H,1-8H2,(H,12,13).
What are the key properties of 2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid?
2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid has a molecular weight of 214.26 g/mol, XLogP of 1.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid is sourced from PubChem (CID 79899396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).