C12H20O5S — CID 79911733
3-(1,9-dioxaspiro[5.5]undecan-4-ylsulfinyl)propanoic acid (PubChem CID 79911733) has the molecular formula C12H20O5S and a molecular weight of 276.35 g/mol. Its IUPAC name is 3-(1,9-dioxaspiro[5.5]undecan-4-ylsulfinyl)propanoic acid.
| Compound Name | 3-(1,9-dioxaspiro[5.5]undecan-4-ylsulfinyl)propanoic acid |
|---|---|
| PubChem CID | 79911733 |
| Molecular Formula | C12H20O5S |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 3-(1,9-dioxaspiro[5.5]undecan-4-ylsulfinyl)propanoic acid |
| SMILES | O=C(O)CCS(=O)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C12H20O5S/c13-11(14)2-8-18(15)10-1-5-17-12(9-10)3-6-16-7-4-12/h10H,1-9H2,(H,13,14) |
| InChIKey | PPBYJRHCNOPWEN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |