2-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]acetic acid

C13H23NO4 — CID 79894049

IUPAC2-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]acetic acid
SMILESCCN(CC(=O)O)C1CCOC2(CCOCC2)C1
InChIInChI=1S/C13H23NO4/c1-2-14(10-12(15)16)11-3-6-18-13(9-11)4-7-17-8-5-13/h11H,2-10H2,1H3,(H,15,16)
InChIKeyWLEPJLCQBGURPH-UHFFFAOYSA-N
MW257.33 g/mol
LogP1.12
Rot. Bonds4

About 2-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]acetic acid

2-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]acetic acid (PubChem CID 79894049) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]acetic acid.

Molecular Properties

Compound Name2-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]acetic acid
PubChem CID79894049
Molecular FormulaC13H23NO4
Molecular Weight257.33 g/mol
Exact Mass257.16
IUPAC Name2-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]acetic acid
SMILESCCN(CC(=O)O)C1CCOC2(CCOCC2)C1
InChIInChI=1S/C13H23NO4/c1-2-14(10-12(15)16)11-3-6-18-13(9-11)4-7-17-8-5-13/h11H,2-10H2,1H3,(H,15,16)
InChIKeyWLEPJLCQBGURPH-UHFFFAOYSA-N
XLogP1.12
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.33
LogP ≤ 51.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]acetic acid?
The IUPAC name of 2-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]acetic acid (CID 79894049) is 2-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]acetic acid.
What is the SMILES notation for 2-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]acetic acid?
The canonical SMILES for 2-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]acetic acid is CCN(CC(=O)O)C1CCOC2(CCOCC2)C1.
What is the InChIKey of 2-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]acetic acid?
The InChIKey is WLEPJLCQBGURPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO4/c1-2-14(10-12(15)16)11-3-6-18-13(9-11)4-7-17-8-5-13/h11H,2-10H2,1H3,(H,15,16).
What are the key properties of 2-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]acetic acid?
2-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]acetic acid has a molecular weight of 257.33 g/mol, XLogP of 1.12, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]acetic acid is sourced from PubChem (CID 79894049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).