C15H29NO3 — CID 79919295
2-[butyl(1,9-dioxaspiro[5.5]undecan-4-yl)amino]ethanol (PubChem CID 79919295) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is 2-[butyl(1,9-dioxaspiro[5.5]undecan-4-yl)amino]ethanol.
| Compound Name | 2-[butyl(1,9-dioxaspiro[5.5]undecan-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 79919295 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | 2-[butyl(1,9-dioxaspiro[5.5]undecan-4-yl)amino]ethanol |
| SMILES | CCCCN(CCO)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C15H29NO3/c1-2-3-7-16(8-9-17)14-4-10-19-15(13-14)5-11-18-12-6-15/h14,17H,2-13H2,1H3 |
| InChIKey | XZFNIDYEDOVCPW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |