methyl 3-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]propanoate

C15H27NO4 — CID 79919754

IUPACmethyl 3-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]propanoate
SMILESCCN(CCC(=O)OC)C1CCOC2(CCOCC2)C1
InChIInChI=1S/C15H27NO4/c1-3-16(8-4-14(17)18-2)13-5-9-20-15(12-13)6-10-19-11-7-15/h13H,3-12H2,1-2H3
InChIKeyWYBPDTLGGHZOLB-UHFFFAOYSA-N
MW285.38 g/mol
LogP1.60
Rot. Bonds5

About methyl 3-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]propanoate

methyl 3-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]propanoate (PubChem CID 79919754) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is methyl 3-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]propanoate.

Molecular Properties

Compound Namemethyl 3-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]propanoate
PubChem CID79919754
Molecular FormulaC15H27NO4
Molecular Weight285.38 g/mol
Exact Mass285.19
IUPAC Namemethyl 3-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]propanoate
SMILESCCN(CCC(=O)OC)C1CCOC2(CCOCC2)C1
InChIInChI=1S/C15H27NO4/c1-3-16(8-4-14(17)18-2)13-5-9-20-15(12-13)6-10-19-11-7-15/h13H,3-12H2,1-2H3
InChIKeyWYBPDTLGGHZOLB-UHFFFAOYSA-N
XLogP1.60
TPSA48.00 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.38
LogP ≤ 51.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 3-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]propanoate?
The IUPAC name of methyl 3-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]propanoate (CID 79919754) is methyl 3-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]propanoate.
What is the SMILES notation for methyl 3-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]propanoate?
The canonical SMILES for methyl 3-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]propanoate is CCN(CCC(=O)OC)C1CCOC2(CCOCC2)C1.
What is the InChIKey of methyl 3-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]propanoate?
The InChIKey is WYBPDTLGGHZOLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO4/c1-3-16(8-4-14(17)18-2)13-5-9-20-15(12-13)6-10-19-11-7-15/h13H,3-12H2,1-2H3.
What are the key properties of methyl 3-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]propanoate?
methyl 3-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]propanoate has a molecular weight of 285.38 g/mol, XLogP of 1.60, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[1,9-dioxaspiro[5.5]undecan-4-yl(ethyl)amino]propanoate is sourced from PubChem (CID 79919754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).