C13H23NO4 — CID 79894913
methyl 3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)propanoate (PubChem CID 79894913) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is methyl 3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)propanoate.
| Compound Name | methyl 3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)propanoate |
|---|---|
| PubChem CID | 79894913 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | methyl 3-(1,9-dioxaspiro[5.5]undecan-4-ylamino)propanoate |
| SMILES | COC(=O)CCNC1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C13H23NO4/c1-16-12(15)2-6-14-11-3-7-18-13(10-11)4-8-17-9-5-13/h11,14H,2-10H2,1H3 |
| InChIKey | GZMYXEFBBRSYRB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |