C14H26N2O3 — CID 106237589
5-(1,9-dioxaspiro[5.5]undecan-4-ylamino)pentanamide (PubChem CID 106237589) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 5-(1,9-dioxaspiro[5.5]undecan-4-ylamino)pentanamide.
| Compound Name | 5-(1,9-dioxaspiro[5.5]undecan-4-ylamino)pentanamide |
|---|---|
| PubChem CID | 106237589 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 5-(1,9-dioxaspiro[5.5]undecan-4-ylamino)pentanamide |
| SMILES | NC(=O)CCCCNC1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C14H26N2O3/c15-13(17)3-1-2-7-16-12-4-8-19-14(11-12)5-9-18-10-6-14/h12,16H,1-11H2,(H2,15,17) |
| InChIKey | ZNSCLVGYGYHGDU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|