C12H23NO3 — CID 79898117
N-(3-methoxypropyl)-2,6-dioxaspiro[4.5]decan-9-amine (PubChem CID 79898117) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2,6-dioxaspiro[4.5]decan-9-amine.
| Compound Name | N-(3-methoxypropyl)-2,6-dioxaspiro[4.5]decan-9-amine |
|---|---|
| PubChem CID | 79898117 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | N-(3-methoxypropyl)-2,6-dioxaspiro[4.5]decan-9-amine |
| SMILES | COCCCNC1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C12H23NO3/c1-14-6-2-5-13-11-3-7-16-12(9-11)4-8-15-10-12/h11,13H,2-10H2,1H3 |
| InChIKey | SIZUBIUTEALJRP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|