C14H28N2O4S — CID 79902853
N-[3-(2,6-dioxaspiro[4.5]decan-9-ylamino)propyl]-N-ethylmethanesulfonamide (PubChem CID 79902853) has the molecular formula C14H28N2O4S and a molecular weight of 320.46 g/mol. Its IUPAC name is N-[3-(2,6-dioxaspiro[4.5]decan-9-ylamino)propyl]-N-ethylmethanesulfonamide.
| Compound Name | N-[3-(2,6-dioxaspiro[4.5]decan-9-ylamino)propyl]-N-ethylmethanesulfonamide |
|---|---|
| PubChem CID | 79902853 |
| Molecular Formula | C14H28N2O4S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | N-[3-(2,6-dioxaspiro[4.5]decan-9-ylamino)propyl]-N-ethylmethanesulfonamide |
| SMILES | CCN(CCCNC1CCOC2(CCOC2)C1)S(C)(=O)=O |
| InChI | InChI=1S/C14H28N2O4S/c1-3-16(21(2,17)18)8-4-7-15-13-5-9-20-14(11-13)6-10-19-12-14/h13,15H,3-12H2,1-2H3 |
| InChIKey | HEIBWOKQUITBPC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|