C14H24N2O3 — CID 129347011
1-cyclopropyl-3-[(5R,9S)-2,6-dioxaspiro[4.5]decan-9-yl]-1-ethylurea (PubChem CID 129347011) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(5R,9S)-2,6-dioxaspiro[4.5]decan-9-yl]-1-ethylurea.
| Compound Name | 1-cyclopropyl-3-[(5R,9S)-2,6-dioxaspiro[4.5]decan-9-yl]-1-ethylurea |
|---|---|
| PubChem CID | 129347011 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-cyclopropyl-3-[(5R,9S)-2,6-dioxaspiro[4.5]decan-9-yl]-1-ethylurea |
| SMILES | CCN(C(=O)N[C@H]1CCO[C@@]2(CCOC2)C1)C1CC1 |
| InChI | InChI=1S/C14H24N2O3/c1-2-16(12-3-4-12)13(17)15-11-5-7-19-14(9-11)6-8-18-10-14/h11-12H,2-10H2,1H3,(H,15,17)/t11-,14-/m0/s1 |
| InChIKey | BRWBJSSPJSSVAO-FZMZJTMJSA-N |
| XLogP | 1.52 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |