C11H21NO2S — CID 79904121
N-(2-methylsulfanylethyl)-2,6-dioxaspiro[4.5]decan-9-amine (PubChem CID 79904121) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is N-(2-methylsulfanylethyl)-2,6-dioxaspiro[4.5]decan-9-amine.
| Compound Name | N-(2-methylsulfanylethyl)-2,6-dioxaspiro[4.5]decan-9-amine |
|---|---|
| PubChem CID | 79904121 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | N-(2-methylsulfanylethyl)-2,6-dioxaspiro[4.5]decan-9-amine |
| SMILES | CSCCNC1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C11H21NO2S/c1-15-7-4-12-10-2-5-14-11(8-10)3-6-13-9-11/h10,12H,2-9H2,1H3 |
| InChIKey | GYRWVGDLNWQCQU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|