C16H31N3O2 — CID 79902458
3-[1,9-dioxaspiro[5.5]undecan-4-yl(2-methylpropyl)amino]propanimidamide (PubChem CID 79902458) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is 3-[1,9-dioxaspiro[5.5]undecan-4-yl(2-methylpropyl)amino]propanimidamide.
| Compound Name | 3-[1,9-dioxaspiro[5.5]undecan-4-yl(2-methylpropyl)amino]propanimidamide |
|---|---|
| PubChem CID | 79902458 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | 3-[1,9-dioxaspiro[5.5]undecan-4-yl(2-methylpropyl)amino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(CC(C)C)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C16H31N3O2/c1-13(2)12-19(7-3-15(17)18)14-4-8-21-16(11-14)5-9-20-10-6-16/h13-14H,3-12H2,1-2H3,(H3,17,18) |
| InChIKey | JUWJPOFDRHJNBS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 71.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|