C15H28N2OS2 — CID 79906024
3-[2-methylpropyl(6-oxa-2-thiaspiro[4.5]decan-9-yl)amino]propanethioamide (PubChem CID 79906024) has the molecular formula C15H28N2OS2 and a molecular weight of 316.54 g/mol. Its IUPAC name is 3-[2-methylpropyl(6-oxa-2-thiaspiro[4.5]decan-9-yl)amino]propanethioamide.
| Compound Name | 3-[2-methylpropyl(6-oxa-2-thiaspiro[4.5]decan-9-yl)amino]propanethioamide |
|---|---|
| PubChem CID | 79906024 |
| Molecular Formula | C15H28N2OS2 |
| Molecular Weight | 316.54 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 3-[2-methylpropyl(6-oxa-2-thiaspiro[4.5]decan-9-yl)amino]propanethioamide |
| SMILES | CC(C)CN(CCC(N)=S)C1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C15H28N2OS2/c1-12(2)10-17(6-3-14(16)19)13-4-7-18-15(9-13)5-8-20-11-15/h12-13H,3-11H2,1-2H3,(H2,16,19) |
| InChIKey | NMJCJOMRJWZZPH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|