C9H20N2OS — CID 105249480
[3-methyl-1-(1,4-oxathian-2-yl)butyl]hydrazine (PubChem CID 105249480) has the molecular formula C9H20N2OS and a molecular weight of 204.34 g/mol. Its IUPAC name is [3-methyl-1-(1,4-oxathian-2-yl)butyl]hydrazine.
| Compound Name | [3-methyl-1-(1,4-oxathian-2-yl)butyl]hydrazine |
|---|---|
| PubChem CID | 105249480 |
| Molecular Formula | C9H20N2OS |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | [3-methyl-1-(1,4-oxathian-2-yl)butyl]hydrazine |
| SMILES | CC(C)CC(NN)C1CSCCO1 |
| InChI | InChI=1S/C9H20N2OS/c1-7(2)5-8(11-10)9-6-13-4-3-12-9/h7-9,11H,3-6,10H2,1-2H3 |
| InChIKey | SZECYRUYRDPKBG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|