C17H18O3S — CID 106600903
2,3-dihydro-1,4-benzoxathiin-2-yl-(4-ethoxyphenyl)methanol (PubChem CID 106600903) has the molecular formula C17H18O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzoxathiin-2-yl-(4-ethoxyphenyl)methanol.
| Compound Name | 2,3-dihydro-1,4-benzoxathiin-2-yl-(4-ethoxyphenyl)methanol |
|---|---|
| PubChem CID | 106600903 |
| Molecular Formula | C17H18O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2,3-dihydro-1,4-benzoxathiin-2-yl-(4-ethoxyphenyl)methanol |
| SMILES | CCOc1ccc(C(O)C2CSc3ccccc3O2)cc1 |
| InChI | InChI=1S/C17H18O3S/c1-2-19-13-9-7-12(8-10-13)17(18)15-11-21-16-6-4-3-5-14(16)20-15/h3-10,15,17-18H,2,11H2,1H3 |
| InChIKey | FKBFKKIZMGBDRG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |