C17H17BrO2 — CID 63437355
2-[bromo-(4-ethoxyphenyl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 63437355) has the molecular formula C17H17BrO2 and a molecular weight of 333.23 g/mol. Its IUPAC name is 2-[bromo-(4-ethoxyphenyl)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 2-[bromo-(4-ethoxyphenyl)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 63437355 |
| Molecular Formula | C17H17BrO2 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 2-[bromo-(4-ethoxyphenyl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | CCOc1ccc(C(Br)C2Cc3ccccc3O2)cc1 |
| InChI | InChI=1S/C17H17BrO2/c1-2-19-14-9-7-12(8-10-14)17(18)16-11-13-5-3-4-6-15(13)20-16/h3-10,16-17H,2,11H2,1H3 |
| InChIKey | BTVNBPWQWUTGHX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|