About 2-[(4-butan-2-ylphenyl)-chloromethyl]-2,3-dihydro-1-benzofuran
2-[(4-butan-2-ylphenyl)-chloromethyl]-2,3-dihydro-1-benzofuran (PubChem CID 63430500) has the molecular formula C19H21ClO
and a molecular weight of 300.83 g/mol. Its IUPAC name is 2-[(4-butan-2-ylphenyl)-chloromethyl]-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 2-[(4-butan-2-ylphenyl)-chloromethyl]-2,3-dihydro-1-benzofuran |
| PubChem CID | 63430500 |
| Molecular Formula | C19H21ClO |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-[(4-butan-2-ylphenyl)-chloromethyl]-2,3-dihydro-1-benzofuran |
| SMILES | CCC(C)c1ccc(C(Cl)C2Cc3ccccc3O2)cc1 |
| InChI | InChI=1S/C19H21ClO/c1-3-13(2)14-8-10-15(11-9-14)19(20)18-12-16-6-4-5-7-17(16)21-18/h4-11,13,18-19H,3,12H2,1-2H3 |
| InChIKey | GUDKUMCHNQAZTM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-butan-2-ylphenyl)-chloromethyl]-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-butan-2-ylphenyl)-chloromethyl]-2,3-dihydro-1-benzofuran?
The IUPAC name of 2-[(4-butan-2-ylphenyl)-chloromethyl]-2,3-dihydro-1-benzofuran (CID 63430500) is 2-[(4-butan-2-ylphenyl)-chloromethyl]-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 2-[(4-butan-2-ylphenyl)-chloromethyl]-2,3-dihydro-1-benzofuran?
The canonical SMILES for 2-[(4-butan-2-ylphenyl)-chloromethyl]-2,3-dihydro-1-benzofuran is CCC(C)c1ccc(C(Cl)C2Cc3ccccc3O2)cc1.
What is the InChIKey of 2-[(4-butan-2-ylphenyl)-chloromethyl]-2,3-dihydro-1-benzofuran?
The InChIKey is GUDKUMCHNQAZTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClO/c1-3-13(2)14-8-10-15(11-9-14)19(20)18-12-16-6-4-5-7-17(16)21-18/h4-11,13,18-19H,3,12H2,1-2H3.
What are the key properties of 2-[(4-butan-2-ylphenyl)-chloromethyl]-2,3-dihydro-1-benzofuran?
2-[(4-butan-2-ylphenyl)-chloromethyl]-2,3-dihydro-1-benzofuran has a molecular weight of 300.83 g/mol, XLogP of 5.48, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-butan-2-ylphenyl)-chloromethyl]-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 63430500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).