C14H12BrClOS — CID 79991267
2-[(5-bromo-4-methylthiophen-2-yl)-chloromethyl]-2,3-dihydro-1-benzofuran (PubChem CID 79991267) has the molecular formula C14H12BrClOS and a molecular weight of 343.67 g/mol. Its IUPAC name is 2-[(5-bromo-4-methylthiophen-2-yl)-chloromethyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 2-[(5-bromo-4-methylthiophen-2-yl)-chloromethyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 79991267 |
| Molecular Formula | C14H12BrClOS |
| Molecular Weight | 343.67 g/mol |
| Exact Mass | 341.95 |
| IUPAC Name | 2-[(5-bromo-4-methylthiophen-2-yl)-chloromethyl]-2,3-dihydro-1-benzofuran |
| SMILES | Cc1cc(C(Cl)C2Cc3ccccc3O2)sc1Br |
| InChI | InChI=1S/C14H12BrClOS/c1-8-6-12(18-14(8)15)13(16)11-7-9-4-2-3-5-10(9)17-11/h2-6,11,13H,7H2,1H3 |
| InChIKey | HKWYRGFZDGLNLF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|