C15H14Cl2S — CID 106893999
2-chloro-5-[chloro(2,3-dihydro-1H-inden-2-yl)methyl]-3-methylthiophene (PubChem CID 106893999) has the molecular formula C15H14Cl2S and a molecular weight of 297.25 g/mol. Its IUPAC name is 2-chloro-5-[chloro(2,3-dihydro-1H-inden-2-yl)methyl]-3-methylthiophene.
| Compound Name | 2-chloro-5-[chloro(2,3-dihydro-1H-inden-2-yl)methyl]-3-methylthiophene |
|---|---|
| PubChem CID | 106893999 |
| Molecular Formula | C15H14Cl2S |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 2-chloro-5-[chloro(2,3-dihydro-1H-inden-2-yl)methyl]-3-methylthiophene |
| SMILES | Cc1cc(C(Cl)C2Cc3ccccc3C2)sc1Cl |
| InChI | InChI=1S/C15H14Cl2S/c1-9-6-13(18-15(9)17)14(16)12-7-10-4-2-3-5-11(10)8-12/h2-6,12,14H,7-8H2,1H3 |
| InChIKey | DMKYCXRETNPCMZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|