C13H18Cl2S — CID 102764774
2-chloro-5-[chloro-(2,2,3,3-tetramethylcyclopropyl)methyl]-3-methylthiophene (PubChem CID 102764774) has the molecular formula C13H18Cl2S and a molecular weight of 277.26 g/mol. Its IUPAC name is 2-chloro-5-[chloro-(2,2,3,3-tetramethylcyclopropyl)methyl]-3-methylthiophene.
| Compound Name | 2-chloro-5-[chloro-(2,2,3,3-tetramethylcyclopropyl)methyl]-3-methylthiophene |
|---|---|
| PubChem CID | 102764774 |
| Molecular Formula | C13H18Cl2S |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-chloro-5-[chloro-(2,2,3,3-tetramethylcyclopropyl)methyl]-3-methylthiophene |
| SMILES | Cc1cc(C(Cl)C2C(C)(C)C2(C)C)sc1Cl |
| InChI | InChI=1S/C13H18Cl2S/c1-7-6-8(16-11(7)15)9(14)10-12(2,3)13(10,4)5/h6,9-10H,1-5H3 |
| InChIKey | RSZXXWNLNWBHSL-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|