C13H16Cl2S — CID 102764636
5-[2-bicyclo[2.2.1]heptanyl(chloro)methyl]-2-chloro-3-methylthiophene (PubChem CID 102764636) has the molecular formula C13H16Cl2S and a molecular weight of 275.24 g/mol. Its IUPAC name is 5-[2-bicyclo[2.2.1]heptanyl(chloro)methyl]-2-chloro-3-methylthiophene.
| Compound Name | 5-[2-bicyclo[2.2.1]heptanyl(chloro)methyl]-2-chloro-3-methylthiophene |
|---|---|
| PubChem CID | 102764636 |
| Molecular Formula | C13H16Cl2S |
| Molecular Weight | 275.24 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 5-[2-bicyclo[2.2.1]heptanyl(chloro)methyl]-2-chloro-3-methylthiophene |
| SMILES | Cc1cc(C(Cl)C2CC3CCC2C3)sc1Cl |
| InChI | InChI=1S/C13H16Cl2S/c1-7-4-11(16-13(7)15)12(14)10-6-8-2-3-9(10)5-8/h4,8-10,12H,2-3,5-6H2,1H3 |
| InChIKey | NKOWRDNILRXWEO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.24 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|