C16H20ClFO2 — CID 63447813
2-[chloro-(2-fluoro-4,5-dimethoxyphenyl)methyl]bicyclo[2.2.1]heptane (PubChem CID 63447813) has the molecular formula C16H20ClFO2 and a molecular weight of 298.78 g/mol. Its IUPAC name is 2-[chloro-(2-fluoro-4,5-dimethoxyphenyl)methyl]bicyclo[2.2.1]heptane.
| Compound Name | 2-[chloro-(2-fluoro-4,5-dimethoxyphenyl)methyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 63447813 |
| Molecular Formula | C16H20ClFO2 |
| Molecular Weight | 298.78 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-[chloro-(2-fluoro-4,5-dimethoxyphenyl)methyl]bicyclo[2.2.1]heptane |
| SMILES | COc1cc(F)c(C(Cl)C2CC3CCC2C3)cc1OC |
| InChI | InChI=1S/C16H20ClFO2/c1-19-14-7-12(13(18)8-15(14)20-2)16(17)11-6-9-3-4-10(11)5-9/h7-11,16H,3-6H2,1-2H3 |
| InChIKey | LUJDHXUBMSTXAW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.78 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|