C12H14ClFO2 — CID 62865876
1-[chloro(cyclopropyl)methyl]-2-fluoro-4,5-dimethoxybenzene (PubChem CID 62865876) has the molecular formula C12H14ClFO2 and a molecular weight of 244.69 g/mol. Its IUPAC name is 1-[chloro(cyclopropyl)methyl]-2-fluoro-4,5-dimethoxybenzene.
| Compound Name | 1-[chloro(cyclopropyl)methyl]-2-fluoro-4,5-dimethoxybenzene |
|---|---|
| PubChem CID | 62865876 |
| Molecular Formula | C12H14ClFO2 |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1-[chloro(cyclopropyl)methyl]-2-fluoro-4,5-dimethoxybenzene |
| SMILES | COc1cc(F)c(C(Cl)C2CC2)cc1OC |
| InChI | InChI=1S/C12H14ClFO2/c1-15-10-5-8(12(13)7-3-4-7)9(14)6-11(10)16-2/h5-7,12H,3-4H2,1-2H3 |
| InChIKey | SWVGBYYBAJQHQQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|