C14H18Cl2O3 — CID 62906748
4-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]oxane (PubChem CID 62906748) has the molecular formula C14H18Cl2O3 and a molecular weight of 305.20 g/mol. Its IUPAC name is 4-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]oxane.
| Compound Name | 4-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]oxane |
|---|---|
| PubChem CID | 62906748 |
| Molecular Formula | C14H18Cl2O3 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 4-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]oxane |
| SMILES | COc1cc(Cl)c(C(Cl)C2CCOCC2)cc1OC |
| InChI | InChI=1S/C14H18Cl2O3/c1-17-12-7-10(11(15)8-13(12)18-2)14(16)9-3-5-19-6-4-9/h7-9,14H,3-6H2,1-2H3 |
| InChIKey | KYGKMMKRPFTSNM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|