C17H22BrClO2 — CID 63432659
2-[2-(2-bromo-4,5-dimethoxyphenyl)-2-chloroethyl]bicyclo[2.2.1]heptane (PubChem CID 63432659) has the molecular formula C17H22BrClO2 and a molecular weight of 373.72 g/mol. Its IUPAC name is 2-[2-(2-bromo-4,5-dimethoxyphenyl)-2-chloroethyl]bicyclo[2.2.1]heptane.
| Compound Name | 2-[2-(2-bromo-4,5-dimethoxyphenyl)-2-chloroethyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 63432659 |
| Molecular Formula | C17H22BrClO2 |
| Molecular Weight | 373.72 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 2-[2-(2-bromo-4,5-dimethoxyphenyl)-2-chloroethyl]bicyclo[2.2.1]heptane |
| SMILES | COc1cc(Br)c(C(Cl)CC2CC3CCC2C3)cc1OC |
| InChI | InChI=1S/C17H22BrClO2/c1-20-16-8-13(14(18)9-17(16)21-2)15(19)7-12-6-10-3-4-11(12)5-10/h8-12,15H,3-7H2,1-2H3 |
| InChIKey | MCSKWYJIVIZFRB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.72 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|