C16H19ClF2O — CID 63427554
2-[2-chloro-2-(2,6-difluoro-4-methoxyphenyl)ethyl]bicyclo[2.2.1]heptane (PubChem CID 63427554) has the molecular formula C16H19ClF2O and a molecular weight of 300.78 g/mol. Its IUPAC name is 2-[2-chloro-2-(2,6-difluoro-4-methoxyphenyl)ethyl]bicyclo[2.2.1]heptane.
| Compound Name | 2-[2-chloro-2-(2,6-difluoro-4-methoxyphenyl)ethyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 63427554 |
| Molecular Formula | C16H19ClF2O |
| Molecular Weight | 300.78 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[2-chloro-2-(2,6-difluoro-4-methoxyphenyl)ethyl]bicyclo[2.2.1]heptane |
| SMILES | COc1cc(F)c(C(Cl)CC2CC3CCC2C3)c(F)c1 |
| InChI | InChI=1S/C16H19ClF2O/c1-20-12-7-14(18)16(15(19)8-12)13(17)6-11-5-9-2-3-10(11)4-9/h7-11,13H,2-6H2,1H3 |
| InChIKey | JRMCUVVJWLKCLM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.78 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|