C16H20BrFO — CID 63443197
2-[2-bromo-2-(2-fluoro-4-methoxyphenyl)ethyl]bicyclo[2.2.1]heptane (PubChem CID 63443197) has the molecular formula C16H20BrFO and a molecular weight of 327.24 g/mol. Its IUPAC name is 2-[2-bromo-2-(2-fluoro-4-methoxyphenyl)ethyl]bicyclo[2.2.1]heptane.
| Compound Name | 2-[2-bromo-2-(2-fluoro-4-methoxyphenyl)ethyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 63443197 |
| Molecular Formula | C16H20BrFO |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-[2-bromo-2-(2-fluoro-4-methoxyphenyl)ethyl]bicyclo[2.2.1]heptane |
| SMILES | COc1ccc(C(Br)CC2CC3CCC2C3)c(F)c1 |
| InChI | InChI=1S/C16H20BrFO/c1-19-13-4-5-14(16(18)9-13)15(17)8-12-7-10-2-3-11(12)6-10/h4-5,9-12,15H,2-3,6-8H2,1H3 |
| InChIKey | DIAKNUAQDVGYEY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|