C17H23Br — CID 55198191
2-[2-bromo-2-(2,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane (PubChem CID 55198191) has the molecular formula C17H23Br and a molecular weight of 307.27 g/mol. Its IUPAC name is 2-[2-bromo-2-(2,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane.
| Compound Name | 2-[2-bromo-2-(2,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 55198191 |
| Molecular Formula | C17H23Br |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-[2-bromo-2-(2,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane |
| SMILES | Cc1ccc(C)c(C(Br)CC2CC3CCC2C3)c1 |
| InChI | InChI=1S/C17H23Br/c1-11-3-4-12(2)16(7-11)17(18)10-15-9-13-5-6-14(15)8-13/h3-4,7,13-15,17H,5-6,8-10H2,1-2H3 |
| InChIKey | LLNKBCCNKPPJCB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|