About 2-[2-bromo-2-(2-chloro-4,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane
2-[2-bromo-2-(2-chloro-4,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane (PubChem CID 115484866) has the molecular formula C17H22BrCl
and a molecular weight of 341.72 g/mol. Its IUPAC name is 2-[2-bromo-2-(2-chloro-4,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 2-[2-bromo-2-(2-chloro-4,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane |
| PubChem CID | 115484866 |
| Molecular Formula | C17H22BrCl |
| Molecular Weight | 341.72 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 2-[2-bromo-2-(2-chloro-4,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane |
| SMILES | Cc1cc(Cl)c(C(Br)CC2CC3CCC2C3)cc1C |
| InChI | InChI=1S/C17H22BrCl/c1-10-5-15(17(19)6-11(10)2)16(18)9-14-8-12-3-4-13(14)7-12/h5-6,12-14,16H,3-4,7-9H2,1-2H3 |
| InChIKey | REJJTYFINYXZBV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.72 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-bromo-2-(2-chloro-4,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-bromo-2-(2-chloro-4,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane?
The IUPAC name of 2-[2-bromo-2-(2-chloro-4,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane (CID 115484866) is 2-[2-bromo-2-(2-chloro-4,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane.
What is the SMILES notation for 2-[2-bromo-2-(2-chloro-4,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane?
The canonical SMILES for 2-[2-bromo-2-(2-chloro-4,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane is Cc1cc(Cl)c(C(Br)CC2CC3CCC2C3)cc1C.
What is the InChIKey of 2-[2-bromo-2-(2-chloro-4,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane?
The InChIKey is REJJTYFINYXZBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22BrCl/c1-10-5-15(17(19)6-11(10)2)16(18)9-14-8-12-3-4-13(14)7-12/h5-6,12-14,16H,3-4,7-9H2,1-2H3.
What are the key properties of 2-[2-bromo-2-(2-chloro-4,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane?
2-[2-bromo-2-(2-chloro-4,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane has a molecular weight of 341.72 g/mol, XLogP of 6.22, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-bromo-2-(2-chloro-4,5-dimethylphenyl)ethyl]bicyclo[2.2.1]heptane is sourced from PubChem (CID 115484866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).