C16H20Cl2O — CID 63428698
2-[2-chloro-2-(3-chloro-4-methoxyphenyl)ethyl]bicyclo[2.2.1]heptane (PubChem CID 63428698) has the molecular formula C16H20Cl2O and a molecular weight of 299.24 g/mol. Its IUPAC name is 2-[2-chloro-2-(3-chloro-4-methoxyphenyl)ethyl]bicyclo[2.2.1]heptane.
| Compound Name | 2-[2-chloro-2-(3-chloro-4-methoxyphenyl)ethyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 63428698 |
| Molecular Formula | C16H20Cl2O |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-[2-chloro-2-(3-chloro-4-methoxyphenyl)ethyl]bicyclo[2.2.1]heptane |
| SMILES | COc1ccc(C(Cl)CC2CC3CCC2C3)cc1Cl |
| InChI | InChI=1S/C16H20Cl2O/c1-19-16-5-4-12(8-15(16)18)14(17)9-13-7-10-2-3-11(13)6-10/h4-5,8,10-11,13-14H,2-3,6-7,9H2,1H3 |
| InChIKey | ITFKNZMRWHYZSL-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|