C17H23ClO — CID 55199641
2-[2-chloro-2-(4-ethoxyphenyl)ethyl]bicyclo[2.2.1]heptane (PubChem CID 55199641) has the molecular formula C17H23ClO and a molecular weight of 278.82 g/mol. Its IUPAC name is 2-[2-chloro-2-(4-ethoxyphenyl)ethyl]bicyclo[2.2.1]heptane.
| Compound Name | 2-[2-chloro-2-(4-ethoxyphenyl)ethyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 55199641 |
| Molecular Formula | C17H23ClO |
| Molecular Weight | 278.82 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-[2-chloro-2-(4-ethoxyphenyl)ethyl]bicyclo[2.2.1]heptane |
| SMILES | CCOc1ccc(C(Cl)CC2CC3CCC2C3)cc1 |
| InChI | InChI=1S/C17H23ClO/c1-2-19-16-7-5-13(6-8-16)17(18)11-15-10-12-3-4-14(15)9-12/h5-8,12,14-15,17H,2-4,9-11H2,1H3 |
| InChIKey | QNILDFRLEZLDRL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.82 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|