C15H21ClS — CID 63430948
2-[2-(2-bicyclo[2.2.1]heptanyl)-1-chloroethyl]-5-ethylthiophene (PubChem CID 63430948) has the molecular formula C15H21ClS and a molecular weight of 268.85 g/mol. Its IUPAC name is 2-[2-(2-bicyclo[2.2.1]heptanyl)-1-chloroethyl]-5-ethylthiophene.
| Compound Name | 2-[2-(2-bicyclo[2.2.1]heptanyl)-1-chloroethyl]-5-ethylthiophene |
|---|---|
| PubChem CID | 63430948 |
| Molecular Formula | C15H21ClS |
| Molecular Weight | 268.85 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-[2-(2-bicyclo[2.2.1]heptanyl)-1-chloroethyl]-5-ethylthiophene |
| SMILES | CCc1ccc(C(Cl)CC2CC3CCC2C3)s1 |
| InChI | InChI=1S/C15H21ClS/c1-2-13-5-6-15(17-13)14(16)9-12-8-10-3-4-11(12)7-10/h5-6,10-12,14H,2-4,7-9H2,1H3 |
| InChIKey | WRCWVSWDXDHEDR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.85 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|