C17H26ClNS — CID 102764234
N-[2-(2-bicyclo[2.2.1]heptanyl)-1-(5-chloro-4-methylthiophen-2-yl)ethyl]propan-1-amine (PubChem CID 102764234) has the molecular formula C17H26ClNS and a molecular weight of 311.92 g/mol. Its IUPAC name is N-[2-(2-bicyclo[2.2.1]heptanyl)-1-(5-chloro-4-methylthiophen-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(2-bicyclo[2.2.1]heptanyl)-1-(5-chloro-4-methylthiophen-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 102764234 |
| Molecular Formula | C17H26ClNS |
| Molecular Weight | 311.92 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N-[2-(2-bicyclo[2.2.1]heptanyl)-1-(5-chloro-4-methylthiophen-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(CC1CC2CCC1C2)c1cc(C)c(Cl)s1 |
| InChI | InChI=1S/C17H26ClNS/c1-3-6-19-15(16-7-11(2)17(18)20-16)10-14-9-12-4-5-13(14)8-12/h7,12-15,19H,3-6,8-10H2,1-2H3 |
| InChIKey | XITBZYQSQUEHPE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.92 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |