C18H25BrClN — CID 105012937
N-[2-(2-bicyclo[2.2.1]heptanyl)-1-(4-bromo-3-chlorophenyl)ethyl]propan-1-amine (PubChem CID 105012937) has the molecular formula C18H25BrClN and a molecular weight of 370.76 g/mol. Its IUPAC name is N-[2-(2-bicyclo[2.2.1]heptanyl)-1-(4-bromo-3-chlorophenyl)ethyl]propan-1-amine.
| Compound Name | N-[2-(2-bicyclo[2.2.1]heptanyl)-1-(4-bromo-3-chlorophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105012937 |
| Molecular Formula | C18H25BrClN |
| Molecular Weight | 370.76 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | N-[2-(2-bicyclo[2.2.1]heptanyl)-1-(4-bromo-3-chlorophenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(CC1CC2CCC1C2)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C18H25BrClN/c1-2-7-21-18(14-5-6-16(19)17(20)10-14)11-15-9-12-3-4-13(15)8-12/h5-6,10,12-13,15,18,21H,2-4,7-9,11H2,1H3 |
| InChIKey | IZGJMLJQCJPLKA-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.76 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |