C18H26IN — CID 105012704
N-[2-(2-bicyclo[2.2.1]heptanyl)-1-(3-iodophenyl)ethyl]propan-1-amine (PubChem CID 105012704) has the molecular formula C18H26IN and a molecular weight of 383.32 g/mol. Its IUPAC name is N-[2-(2-bicyclo[2.2.1]heptanyl)-1-(3-iodophenyl)ethyl]propan-1-amine.
| Compound Name | N-[2-(2-bicyclo[2.2.1]heptanyl)-1-(3-iodophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105012704 |
| Molecular Formula | C18H26IN |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-[2-(2-bicyclo[2.2.1]heptanyl)-1-(3-iodophenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(CC1CC2CCC1C2)c1cccc(I)c1 |
| InChI | InChI=1S/C18H26IN/c1-2-8-20-18(15-4-3-5-17(19)11-15)12-16-10-13-6-7-14(16)9-13/h3-5,11,13-14,16,18,20H,2,6-10,12H2,1H3 |
| InChIKey | MZALXHOALMAOSB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|