C16H23BrClNO — CID 115847097
N-[1-(4-bromo-3-chlorophenyl)-2-(oxan-4-yl)ethyl]propan-1-amine (PubChem CID 115847097) has the molecular formula C16H23BrClNO and a molecular weight of 360.72 g/mol. Its IUPAC name is N-[1-(4-bromo-3-chlorophenyl)-2-(oxan-4-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(4-bromo-3-chlorophenyl)-2-(oxan-4-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 115847097 |
| Molecular Formula | C16H23BrClNO |
| Molecular Weight | 360.72 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | N-[1-(4-bromo-3-chlorophenyl)-2-(oxan-4-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(CC1CCOCC1)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C16H23BrClNO/c1-2-7-19-16(10-12-5-8-20-9-6-12)13-3-4-14(17)15(18)11-13/h3-4,11-12,16,19H,2,5-10H2,1H3 |
| InChIKey | CAEFDNUUTAISBD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.72 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |