C13H18Cl2OS — CID 102764740
3-[chloro-(5-chloro-4-methylthiophen-2-yl)methyl]-2,4,5-trimethyloxolane (PubChem CID 102764740) has the molecular formula C13H18Cl2OS and a molecular weight of 293.26 g/mol. Its IUPAC name is 3-[chloro-(5-chloro-4-methylthiophen-2-yl)methyl]-2,4,5-trimethyloxolane.
| Compound Name | 3-[chloro-(5-chloro-4-methylthiophen-2-yl)methyl]-2,4,5-trimethyloxolane |
|---|---|
| PubChem CID | 102764740 |
| Molecular Formula | C13H18Cl2OS |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 3-[chloro-(5-chloro-4-methylthiophen-2-yl)methyl]-2,4,5-trimethyloxolane |
| SMILES | Cc1cc(C(Cl)C2C(C)OC(C)C2C)sc1Cl |
| InChI | InChI=1S/C13H18Cl2OS/c1-6-5-10(17-13(6)15)12(14)11-7(2)8(3)16-9(11)4/h5,7-9,11-12H,1-4H3 |
| InChIKey | OAKFMOCNUXBEPN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|