C8H5Cl2F5S — CID 102764813
2-chloro-5-(1-chloro-2,2,3,3,3-pentafluoropropyl)-3-methylthiophene (PubChem CID 102764813) has the molecular formula C8H5Cl2F5S and a molecular weight of 299.09 g/mol. Its IUPAC name is 2-chloro-5-(1-chloro-2,2,3,3,3-pentafluoropropyl)-3-methylthiophene.
| Compound Name | 2-chloro-5-(1-chloro-2,2,3,3,3-pentafluoropropyl)-3-methylthiophene |
|---|---|
| PubChem CID | 102764813 |
| Molecular Formula | C8H5Cl2F5S |
| Molecular Weight | 299.09 g/mol |
| Exact Mass | 297.94 |
| IUPAC Name | 2-chloro-5-(1-chloro-2,2,3,3,3-pentafluoropropyl)-3-methylthiophene |
| SMILES | Cc1cc(C(Cl)C(F)(F)C(F)(F)F)sc1Cl |
| InChI | InChI=1S/C8H5Cl2F5S/c1-3-2-4(16-6(3)10)5(9)7(11,12)8(13,14)15/h2,5H,1H3 |
| InChIKey | XBZSFIMQPVJMAJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.09 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|