C14H11BrClF3S — CID 102764977
5-[1-bromo-2-[4-(trifluoromethyl)phenyl]ethyl]-2-chloro-3-methylthiophene (PubChem CID 102764977) has the molecular formula C14H11BrClF3S and a molecular weight of 383.66 g/mol. Its IUPAC name is 5-[1-bromo-2-[4-(trifluoromethyl)phenyl]ethyl]-2-chloro-3-methylthiophene.
| Compound Name | 5-[1-bromo-2-[4-(trifluoromethyl)phenyl]ethyl]-2-chloro-3-methylthiophene |
|---|---|
| PubChem CID | 102764977 |
| Molecular Formula | C14H11BrClF3S |
| Molecular Weight | 383.66 g/mol |
| Exact Mass | 381.94 |
| IUPAC Name | 5-[1-bromo-2-[4-(trifluoromethyl)phenyl]ethyl]-2-chloro-3-methylthiophene |
| SMILES | Cc1cc(C(Br)Cc2ccc(C(F)(F)F)cc2)sc1Cl |
| InChI | InChI=1S/C14H11BrClF3S/c1-8-6-12(20-13(8)16)11(15)7-9-2-4-10(5-3-9)14(17,18)19/h2-6,11H,7H2,1H3 |
| InChIKey | SLUFSPJZFLTPJD-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.66 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|