C15H10BrClF4 — CID 63531749
1-[1-bromo-2-[4-(trifluoromethyl)phenyl]ethyl]-4-chloro-2-fluorobenzene (PubChem CID 63531749) has the molecular formula C15H10BrClF4 and a molecular weight of 381.59 g/mol. Its IUPAC name is 1-[1-bromo-2-[4-(trifluoromethyl)phenyl]ethyl]-4-chloro-2-fluorobenzene.
| Compound Name | 1-[1-bromo-2-[4-(trifluoromethyl)phenyl]ethyl]-4-chloro-2-fluorobenzene |
|---|---|
| PubChem CID | 63531749 |
| Molecular Formula | C15H10BrClF4 |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | 1-[1-bromo-2-[4-(trifluoromethyl)phenyl]ethyl]-4-chloro-2-fluorobenzene |
| SMILES | Fc1cc(Cl)ccc1C(Br)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10BrClF4/c16-13(12-6-5-11(17)8-14(12)18)7-9-1-3-10(4-2-9)15(19,20)21/h1-6,8,13H,7H2 |
| InChIKey | ADZYJULLKFSVRJ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|