C15H10Br3F3 — CID 107981106
1,3-dibromo-5-[1-bromo-2-[4-(trifluoromethyl)phenyl]ethyl]benzene (PubChem CID 107981106) has the molecular formula C15H10Br3F3 and a molecular weight of 486.95 g/mol. Its IUPAC name is 1,3-dibromo-5-[1-bromo-2-[4-(trifluoromethyl)phenyl]ethyl]benzene.
| Compound Name | 1,3-dibromo-5-[1-bromo-2-[4-(trifluoromethyl)phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 107981106 |
| Molecular Formula | C15H10Br3F3 |
| Molecular Weight | 486.95 g/mol |
| Exact Mass | 483.83 |
| IUPAC Name | 1,3-dibromo-5-[1-bromo-2-[4-(trifluoromethyl)phenyl]ethyl]benzene |
| SMILES | FC(F)(F)c1ccc(CC(Br)c2cc(Br)cc(Br)c2)cc1 |
| InChI | InChI=1S/C15H10Br3F3/c16-12-6-10(7-13(17)8-12)14(18)5-9-1-3-11(4-2-9)15(19,20)21/h1-4,6-8,14H,5H2 |
| InChIKey | FUDXGHUFFPUQTA-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.95 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|