C13H9BrCl2S — CID 102836582
5-[7-bicyclo[4.2.0]octa-1,3,5-trienyl(chloro)methyl]-3-bromo-2-chlorothiophene (PubChem CID 102836582) has the molecular formula C13H9BrCl2S and a molecular weight of 348.09 g/mol. Its IUPAC name is 5-[7-bicyclo[4.2.0]octa-1,3,5-trienyl(chloro)methyl]-3-bromo-2-chlorothiophene.
| Compound Name | 5-[7-bicyclo[4.2.0]octa-1,3,5-trienyl(chloro)methyl]-3-bromo-2-chlorothiophene |
|---|---|
| PubChem CID | 102836582 |
| Molecular Formula | C13H9BrCl2S |
| Molecular Weight | 348.09 g/mol |
| Exact Mass | 345.90 |
| IUPAC Name | 5-[7-bicyclo[4.2.0]octa-1,3,5-trienyl(chloro)methyl]-3-bromo-2-chlorothiophene |
| SMILES | Clc1sc(C(Cl)C2Cc3ccccc32)cc1Br |
| InChI | InChI=1S/C13H9BrCl2S/c14-10-6-11(17-13(10)16)12(15)9-5-7-3-1-2-4-8(7)9/h1-4,6,9,12H,5H2 |
| InChIKey | DHAUDFVSZXPPKK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.09 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|