C16H16BrClS — CID 79991901
2-bromo-5-[chloro(1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-3-methylthiophene (PubChem CID 79991901) has the molecular formula C16H16BrClS and a molecular weight of 355.73 g/mol. Its IUPAC name is 2-bromo-5-[chloro(1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-3-methylthiophene.
| Compound Name | 2-bromo-5-[chloro(1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-3-methylthiophene |
|---|---|
| PubChem CID | 79991901 |
| Molecular Formula | C16H16BrClS |
| Molecular Weight | 355.73 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 2-bromo-5-[chloro(1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-3-methylthiophene |
| SMILES | Cc1cc(C(Cl)C2CCCc3ccccc32)sc1Br |
| InChI | InChI=1S/C16H16BrClS/c1-10-9-14(19-16(10)17)15(18)13-8-4-6-11-5-2-3-7-12(11)13/h2-3,5,7,9,13,15H,4,6,8H2,1H3 |
| InChIKey | GTOMPHDOSLYMLK-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.73 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|